C12H11ClN2O5 — CID 168694834
methyl 1-(4-chloro-2-nitrophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 168694834) has the molecular formula C12H11ClN2O5 and a molecular weight of 298.68 g/mol. Its IUPAC name is methyl 1-(4-chloro-2-nitrophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(4-chloro-2-nitrophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168694834 |
| Molecular Formula | C12H11ClN2O5 |
| Molecular Weight | 298.68 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | methyl 1-(4-chloro-2-nitrophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2ccc(Cl)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H11ClN2O5/c1-20-12(17)7-4-11(16)14(6-7)9-3-2-8(13)5-10(9)15(18)19/h2-3,5,7H,4,6H2,1H3 |
| InChIKey | RSOHJFBYWCSBGR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.68 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|