C12H10ClFN2O5 — CID 168694517
methyl 1-(5-chloro-4-fluoro-2-nitrophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 168694517) has the molecular formula C12H10ClFN2O5 and a molecular weight of 316.67 g/mol. Its IUPAC name is methyl 1-(5-chloro-4-fluoro-2-nitrophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(5-chloro-4-fluoro-2-nitrophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168694517 |
| Molecular Formula | C12H10ClFN2O5 |
| Molecular Weight | 316.67 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | methyl 1-(5-chloro-4-fluoro-2-nitrophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2cc(Cl)c(F)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H10ClFN2O5/c1-21-12(18)6-2-11(17)15(5-6)9-3-7(13)8(14)4-10(9)16(19)20/h3-4,6H,2,5H2,1H3 |
| InChIKey | NXRJQLUVOMPOBA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.67 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|