C12H12BrN3O5 — CID 168660549
4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-bromo-5-nitrobenzoic acid (PubChem CID 168660549) has the molecular formula C12H12BrN3O5 and a molecular weight of 358.15 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-bromo-5-nitrobenzoic acid.
| Compound Name | 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-bromo-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 168660549 |
| Molecular Formula | C12H12BrN3O5 |
| Molecular Weight | 358.15 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-bromo-5-nitrobenzoic acid |
| SMILES | NCC1CC(=O)N(c2c(Br)cc(C(=O)O)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H12BrN3O5/c13-8-2-7(12(18)19)3-9(16(20)21)11(8)15-5-6(4-14)1-10(15)17/h2-3,6H,1,4-5,14H2,(H,18,19) |
| InChIKey | AULFACFVMOLBGY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.15 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|