C13H14ClNO4 — CID 168507565
3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-methoxybenzoic acid (PubChem CID 168507565) has the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-methoxybenzoic acid.
| Compound Name | 3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 168507565 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(N2CC(CCl)CC2=O)c1 |
| InChI | InChI=1S/C13H14ClNO4/c1-19-11-4-9(13(17)18)3-10(5-11)15-7-8(6-14)2-12(15)16/h3-5,8H,2,6-7H2,1H3,(H,17,18) |
| InChIKey | JTCQCFRMJLNZEN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|