C12H13ClN2O3 — CID 168509002
4-amino-3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]benzoic acid (PubChem CID 168509002) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 4-amino-3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 4-amino-3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 168509002 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 4-amino-3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]benzoic acid |
| SMILES | Nc1ccc(C(=O)O)cc1N1CC(CCl)CC1=O |
| InChI | InChI=1S/C12H13ClN2O3/c13-5-7-3-11(16)15(6-7)10-4-8(12(17)18)1-2-9(10)14/h1-2,4,7H,3,5-6,14H2,(H,17,18) |
| InChIKey | LOEIQNGZBIIVIS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|