C12H14ClNO3 — CID 168689664
1-[3,5-bis(hydroxymethyl)phenyl]-4-chloropyrrolidin-2-one (PubChem CID 168689664) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 1-[3,5-bis(hydroxymethyl)phenyl]-4-chloropyrrolidin-2-one.
| Compound Name | 1-[3,5-bis(hydroxymethyl)phenyl]-4-chloropyrrolidin-2-one |
|---|---|
| PubChem CID | 168689664 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 1-[3,5-bis(hydroxymethyl)phenyl]-4-chloropyrrolidin-2-one |
| SMILES | O=C1CC(Cl)CN1c1cc(CO)cc(CO)c1 |
| InChI | InChI=1S/C12H14ClNO3/c13-10-4-12(17)14(5-10)11-2-8(6-15)1-9(3-11)7-16/h1-3,10,15-16H,4-7H2 |
| InChIKey | SDGYVDVMGYOJQE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|