C12H15N3O3 — CID 168698266
1-[3-amino-5-(hydroxymethyl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 168698266) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-[3-amino-5-(hydroxymethyl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-[3-amino-5-(hydroxymethyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168698266 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1-[3-amino-5-(hydroxymethyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(c2cc(N)cc(CO)c2)C1 |
| InChI | InChI=1S/C12H15N3O3/c13-9-1-7(6-16)2-10(4-9)15-5-8(12(14)18)3-11(15)17/h1-2,4,8,16H,3,5-6,13H2,(H2,14,18) |
| InChIKey | BFIGEOIGEQHOSF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|