C13H16N2O3S — CID 168707095
S-[1-[3-amino-5-(hydroxymethyl)phenyl]-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168707095) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is S-[1-[3-amino-5-(hydroxymethyl)phenyl]-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-[3-amino-5-(hydroxymethyl)phenyl]-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168707095 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | S-[1-[3-amino-5-(hydroxymethyl)phenyl]-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2cc(N)cc(CO)c2)C1 |
| InChI | InChI=1S/C13H16N2O3S/c1-8(17)19-12-5-13(18)15(6-12)11-3-9(7-16)2-10(14)4-11/h2-4,12,16H,5-7,14H2,1H3 |
| InChIKey | UKJSMZKVWAYCMF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|