C12H16N2O5S — CID 168719258
1-[3,5-bis(hydroxymethyl)phenyl]-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168719258) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is 1-[3,5-bis(hydroxymethyl)phenyl]-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-[3,5-bis(hydroxymethyl)phenyl]-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168719258 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-[3,5-bis(hydroxymethyl)phenyl]-5-oxopyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2cc(CO)cc(CO)c2)C1 |
| InChI | InChI=1S/C12H16N2O5S/c13-20(18,19)11-4-12(17)14(5-11)10-2-8(6-15)1-9(3-10)7-16/h1-3,11,15-16H,4-7H2,(H2,13,18,19) |
| InChIKey | QPAXDIQLJQPYJZ-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |