C10H10ClNO5S — CID 168689088
3-(4-chloro-2-oxopyrrolidin-1-yl)-4-hydroxybenzenesulfonic acid (PubChem CID 168689088) has the molecular formula C10H10ClNO5S and a molecular weight of 291.71 g/mol. Its IUPAC name is 3-(4-chloro-2-oxopyrrolidin-1-yl)-4-hydroxybenzenesulfonic acid.
| Compound Name | 3-(4-chloro-2-oxopyrrolidin-1-yl)-4-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 168689088 |
| Molecular Formula | C10H10ClNO5S |
| Molecular Weight | 291.71 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 3-(4-chloro-2-oxopyrrolidin-1-yl)-4-hydroxybenzenesulfonic acid |
| SMILES | O=C1CC(Cl)CN1c1cc(S(=O)(=O)O)ccc1O |
| InChI | InChI=1S/C10H10ClNO5S/c11-6-3-10(14)12(5-6)8-4-7(18(15,16)17)1-2-9(8)13/h1-2,4,6,13H,3,5H2,(H,15,16,17) |
| InChIKey | GPJMKJUJSYHVAC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.71 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|