C10H11NO5S2 — CID 168709844
4-hydroxy-3-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzenesulfonic acid (PubChem CID 168709844) has the molecular formula C10H11NO5S2 and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-hydroxy-3-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzenesulfonic acid.
| Compound Name | 4-hydroxy-3-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 168709844 |
| Molecular Formula | C10H11NO5S2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 4-hydroxy-3-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzenesulfonic acid |
| SMILES | O=C1CC(S)CN1c1cc(S(=O)(=O)O)ccc1O |
| InChI | InChI=1S/C10H11NO5S2/c12-9-2-1-7(18(14,15)16)4-8(9)11-5-6(17)3-10(11)13/h1-2,4,6,12,17H,3,5H2,(H,14,15,16) |
| InChIKey | SAUVPQDWDOONFY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|