C11H10INO3S — CID 168709837
4-iodo-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzoic acid (PubChem CID 168709837) has the molecular formula C11H10INO3S and a molecular weight of 363.18 g/mol. Its IUPAC name is 4-iodo-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzoic acid.
| Compound Name | 4-iodo-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 168709837 |
| Molecular Formula | C11H10INO3S |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | 4-iodo-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(I)cc1N1CC(S)CC1=O |
| InChI | InChI=1S/C11H10INO3S/c12-6-1-2-8(11(15)16)9(3-6)13-5-7(17)4-10(13)14/h1-3,7,17H,4-5H2,(H,15,16) |
| InChIKey | LMFITQSDTIMPMY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|