C12H11NO6 — CID 168703296
2-(4-hydroxy-2-oxopyrrolidin-1-yl)terephthalic acid (PubChem CID 168703296) has the molecular formula C12H11NO6 and a molecular weight of 265.22 g/mol. Its IUPAC name is 2-(4-hydroxy-2-oxopyrrolidin-1-yl)terephthalic acid.
| Compound Name | 2-(4-hydroxy-2-oxopyrrolidin-1-yl)terephthalic acid |
|---|---|
| PubChem CID | 168703296 |
| Molecular Formula | C12H11NO6 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2-(4-hydroxy-2-oxopyrrolidin-1-yl)terephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)c(N2CC(O)CC2=O)c1 |
| InChI | InChI=1S/C12H11NO6/c14-7-4-10(15)13(5-7)9-3-6(11(16)17)1-2-8(9)12(18)19/h1-3,7,14H,4-5H2,(H,16,17)(H,18,19) |
| InChIKey | MQSIZZGQJJPPIA-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |