C12H12N2O7S — CID 168718651
2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)terephthalic acid (PubChem CID 168718651) has the molecular formula C12H12N2O7S and a molecular weight of 328.30 g/mol. Its IUPAC name is 2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)terephthalic acid.
| Compound Name | 2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)terephthalic acid |
|---|---|
| PubChem CID | 168718651 |
| Molecular Formula | C12H12N2O7S |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)terephthalic acid |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2cc(C(=O)O)ccc2C(=O)O)C1 |
| InChI | InChI=1S/C12H12N2O7S/c13-22(20,21)7-4-10(15)14(5-7)9-3-6(11(16)17)1-2-8(9)12(18)19/h1-3,7H,4-5H2,(H,16,17)(H,18,19)(H2,13,20,21) |
| InChIKey | GDADXTAFUZTKRG-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |