C10H11N3O5S — CID 168719374
6-(2-oxo-4-sulfamoylpyrrolidin-1-yl)pyridine-2-carboxylic acid (PubChem CID 168719374) has the molecular formula C10H11N3O5S and a molecular weight of 285.28 g/mol. Its IUPAC name is 6-(2-oxo-4-sulfamoylpyrrolidin-1-yl)pyridine-2-carboxylic acid.
| Compound Name | 6-(2-oxo-4-sulfamoylpyrrolidin-1-yl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 168719374 |
| Molecular Formula | C10H11N3O5S |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 6-(2-oxo-4-sulfamoylpyrrolidin-1-yl)pyridine-2-carboxylic acid |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2cccc(C(=O)O)n2)C1 |
| InChI | InChI=1S/C10H11N3O5S/c11-19(17,18)6-4-9(14)13(5-6)8-3-1-2-7(12-8)10(15)16/h1-3,6H,4-5H2,(H,15,16)(H2,11,17,18) |
| InChIKey | ZGHCJGMAZQIEFY-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |