C12H14N2O5S — CID 168717675
4-methyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzoic acid (PubChem CID 168717675) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-methyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzoic acid.
| Compound Name | 4-methyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 168717675 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-methyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(N2CC(S(N)(=O)=O)CC2=O)c1 |
| InChI | InChI=1S/C12H14N2O5S/c1-7-2-3-9(12(16)17)10(4-7)14-6-8(5-11(14)15)20(13,18)19/h2-4,8H,5-6H2,1H3,(H,16,17)(H2,13,18,19) |
| InChIKey | GWECXIXMUHHSTL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |