C11H10F2N2O5S — CID 168718486
3,5-difluoro-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzoic acid (PubChem CID 168718486) has the molecular formula C11H10F2N2O5S and a molecular weight of 320.27 g/mol. Its IUPAC name is 3,5-difluoro-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzoic acid.
| Compound Name | 3,5-difluoro-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 168718486 |
| Molecular Formula | C11H10F2N2O5S |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 3,5-difluoro-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzoic acid |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2c(F)cc(F)cc2C(=O)O)C1 |
| InChI | InChI=1S/C11H10F2N2O5S/c12-5-1-7(11(17)18)10(8(13)2-5)15-4-6(3-9(15)16)21(14,19)20/h1-2,6H,3-4H2,(H,17,18)(H2,14,19,20) |
| InChIKey | DOEVQQYRUUXZTM-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |