C10H11BrFN3O3S — CID 168718565
1-(2-amino-4-bromo-5-fluorophenyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168718565) has the molecular formula C10H11BrFN3O3S and a molecular weight of 352.19 g/mol. Its IUPAC name is 1-(2-amino-4-bromo-5-fluorophenyl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(2-amino-4-bromo-5-fluorophenyl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168718565 |
| Molecular Formula | C10H11BrFN3O3S |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 1-(2-amino-4-bromo-5-fluorophenyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | Nc1cc(Br)c(F)cc1N1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C10H11BrFN3O3S/c11-6-2-8(13)9(3-7(6)12)15-4-5(1-10(15)16)19(14,17)18/h2-3,5H,1,4,13H2,(H2,14,17,18) |
| InChIKey | NYDKABNIOQRCEC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|