C10H12FN3O3S — CID 168719409
1-(2-amino-3-fluorophenyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168719409) has the molecular formula C10H12FN3O3S and a molecular weight of 273.29 g/mol. Its IUPAC name is 1-(2-amino-3-fluorophenyl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(2-amino-3-fluorophenyl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168719409 |
| Molecular Formula | C10H12FN3O3S |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1-(2-amino-3-fluorophenyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | Nc1c(F)cccc1N1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C10H12FN3O3S/c11-7-2-1-3-8(10(7)12)14-5-6(4-9(14)15)18(13,16)17/h1-3,6H,4-5,12H2,(H2,13,16,17) |
| InChIKey | KRDFVKOVIWCSAB-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|