C12H13F3N2O4S — CID 168719005
5-oxo-1-[2-(2,2,2-trifluoroethoxy)phenyl]pyrrolidine-3-sulfonamide (PubChem CID 168719005) has the molecular formula C12H13F3N2O4S and a molecular weight of 338.31 g/mol. Its IUPAC name is 5-oxo-1-[2-(2,2,2-trifluoroethoxy)phenyl]pyrrolidine-3-sulfonamide.
| Compound Name | 5-oxo-1-[2-(2,2,2-trifluoroethoxy)phenyl]pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168719005 |
| Molecular Formula | C12H13F3N2O4S |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 5-oxo-1-[2-(2,2,2-trifluoroethoxy)phenyl]pyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2ccccc2OCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H13F3N2O4S/c13-12(14,15)7-21-10-4-2-1-3-9(10)17-6-8(5-11(17)18)22(16,19)20/h1-4,8H,5-7H2,(H2,16,19,20) |
| InChIKey | KXHWXAOBXXFTOL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |