C13H11F2NO4S — CID 168706322
2-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-3,5-difluorobenzoic acid (PubChem CID 168706322) has the molecular formula C13H11F2NO4S and a molecular weight of 315.30 g/mol. Its IUPAC name is 2-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-3,5-difluorobenzoic acid.
| Compound Name | 2-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 168706322 |
| Molecular Formula | C13H11F2NO4S |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-3,5-difluorobenzoic acid |
| SMILES | CC(=O)SC1CC(=O)N(c2c(F)cc(F)cc2C(=O)O)C1 |
| InChI | InChI=1S/C13H11F2NO4S/c1-6(17)21-8-4-11(18)16(5-8)12-9(13(19)20)2-7(14)3-10(12)15/h2-3,8H,4-5H2,1H3,(H,19,20) |
| InChIKey | RJMUPDYVWAFZGL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|