C12H12BrFN2O2S — CID 168707125
S-[1-(2-amino-6-bromo-4-fluorophenyl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168707125) has the molecular formula C12H12BrFN2O2S and a molecular weight of 347.21 g/mol. Its IUPAC name is S-[1-(2-amino-6-bromo-4-fluorophenyl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(2-amino-6-bromo-4-fluorophenyl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168707125 |
| Molecular Formula | C12H12BrFN2O2S |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | S-[1-(2-amino-6-bromo-4-fluorophenyl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2c(N)cc(F)cc2Br)C1 |
| InChI | InChI=1S/C12H12BrFN2O2S/c1-6(17)19-8-4-11(18)16(5-8)12-9(13)2-7(14)3-10(12)15/h2-3,8H,4-5,15H2,1H3 |
| InChIKey | ANRJHYNTKOENQH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|