C12H10BrF2NO2S — CID 168706365
S-[1-(5-bromo-2,4-difluorophenyl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168706365) has the molecular formula C12H10BrF2NO2S and a molecular weight of 350.18 g/mol. Its IUPAC name is S-[1-(5-bromo-2,4-difluorophenyl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(5-bromo-2,4-difluorophenyl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168706365 |
| Molecular Formula | C12H10BrF2NO2S |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | S-[1-(5-bromo-2,4-difluorophenyl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2cc(Br)c(F)cc2F)C1 |
| InChI | InChI=1S/C12H10BrF2NO2S/c1-6(17)19-7-2-12(18)16(5-7)11-3-8(13)9(14)4-10(11)15/h3-4,7H,2,5H2,1H3 |
| InChIKey | ZWDZAPNEWQTKRD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|