C12H12FNO3S — CID 168706794
S-[1-(2-fluoro-4-hydroxyphenyl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168706794) has the molecular formula C12H12FNO3S and a molecular weight of 269.30 g/mol. Its IUPAC name is S-[1-(2-fluoro-4-hydroxyphenyl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(2-fluoro-4-hydroxyphenyl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168706794 |
| Molecular Formula | C12H12FNO3S |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | S-[1-(2-fluoro-4-hydroxyphenyl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2ccc(O)cc2F)C1 |
| InChI | InChI=1S/C12H12FNO3S/c1-7(15)18-9-5-12(17)14(6-9)11-3-2-8(16)4-10(11)13/h2-4,9,16H,5-6H2,1H3 |
| InChIKey | KVTVVRYZJDRIOD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|