C7H9N5O3S — CID 168719634
5-oxo-1-(1,3,5-triazin-2-yl)pyrrolidine-3-sulfonamide (PubChem CID 168719634) has the molecular formula C7H9N5O3S and a molecular weight of 243.25 g/mol. Its IUPAC name is 5-oxo-1-(1,3,5-triazin-2-yl)pyrrolidine-3-sulfonamide.
| Compound Name | 5-oxo-1-(1,3,5-triazin-2-yl)pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168719634 |
| Molecular Formula | C7H9N5O3S |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 5-oxo-1-(1,3,5-triazin-2-yl)pyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2ncncn2)C1 |
| InChI | InChI=1S/C7H9N5O3S/c8-16(14,15)5-1-6(13)12(2-5)7-10-3-9-4-11-7/h3-5H,1-2H2,(H2,8,14,15) |
| InChIKey | FVQHHFHJXNWTGO-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |