C12H12N4O4S — CID 168719599
1-[4-(furan-2-yl)pyrimidin-2-yl]-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168719599) has the molecular formula C12H12N4O4S and a molecular weight of 308.32 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)pyrimidin-2-yl]-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-[4-(furan-2-yl)pyrimidin-2-yl]-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168719599 |
| Molecular Formula | C12H12N4O4S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 1-[4-(furan-2-yl)pyrimidin-2-yl]-5-oxopyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2nccc(-c3ccco3)n2)C1 |
| InChI | InChI=1S/C12H12N4O4S/c13-21(18,19)8-6-11(17)16(7-8)12-14-4-3-9(15-12)10-2-1-5-20-10/h1-5,8H,6-7H2,(H2,13,18,19) |
| InChIKey | UVWBQAGXJBJPOE-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |