C10H10F3N3O3S — CID 168719368
5-oxo-1-[6-(trifluoromethyl)-2-pyridinyl]pyrrolidine-3-sulfonamide (PubChem CID 168719368) has the molecular formula C10H10F3N3O3S and a molecular weight of 309.27 g/mol. Its IUPAC name is 5-oxo-1-[6-(trifluoromethyl)-2-pyridinyl]pyrrolidine-3-sulfonamide.
| Compound Name | 5-oxo-1-[6-(trifluoromethyl)-2-pyridinyl]pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168719368 |
| Molecular Formula | C10H10F3N3O3S |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 5-oxo-1-[6-(trifluoromethyl)-2-pyridinyl]pyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2cccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C10H10F3N3O3S/c11-10(12,13)7-2-1-3-8(15-7)16-5-6(4-9(16)17)20(14,18)19/h1-3,6H,4-5H2,(H2,14,18,19) |
| InChIKey | DCGGFPKQDWFKKE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |