C12H12INO3S — CID 168671435
4-iodo-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzoic acid (PubChem CID 168671435) has the molecular formula C12H12INO3S and a molecular weight of 377.20 g/mol. Its IUPAC name is 4-iodo-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzoic acid.
| Compound Name | 4-iodo-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 168671435 |
| Molecular Formula | C12H12INO3S |
| Molecular Weight | 377.20 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | 4-iodo-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(I)cc1N1CC(CS)CC1=O |
| InChI | InChI=1S/C12H12INO3S/c13-8-1-2-9(12(16)17)10(4-8)14-5-7(6-18)3-11(14)15/h1-2,4,7,18H,3,5-6H2,(H,16,17) |
| InChIKey | UQIZFAWZQSUNLV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|