C11H11BrN2O3S — CID 168671826
5-bromo-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]pyridine-4-carboxylic acid (PubChem CID 168671826) has the molecular formula C11H11BrN2O3S and a molecular weight of 331.19 g/mol. Its IUPAC name is 5-bromo-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]pyridine-4-carboxylic acid.
| Compound Name | 5-bromo-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 168671826 |
| Molecular Formula | C11H11BrN2O3S |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 5-bromo-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(N2CC(CS)CC2=O)ncc1Br |
| InChI | InChI=1S/C11H11BrN2O3S/c12-8-3-13-9(2-7(8)11(16)17)14-4-6(5-18)1-10(14)15/h2-3,6,18H,1,4-5H2,(H,16,17) |
| InChIKey | KHGVJLYTXYRBAU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|