C12H11F2NO3S — CID 168672081
2,3-difluoro-4-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzoic acid (PubChem CID 168672081) has the molecular formula C12H11F2NO3S and a molecular weight of 287.29 g/mol. Its IUPAC name is 2,3-difluoro-4-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzoic acid.
| Compound Name | 2,3-difluoro-4-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 168672081 |
| Molecular Formula | C12H11F2NO3S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2,3-difluoro-4-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2CC(CS)CC2=O)c(F)c1F |
| InChI | InChI=1S/C12H11F2NO3S/c13-10-7(12(17)18)1-2-8(11(10)14)15-4-6(5-19)3-9(15)16/h1-2,6,19H,3-5H2,(H,17,18) |
| InChIKey | PMQFAXSABAHFJC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|