C20H18ClN3O2S — CID 141376612
3-(7-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-yl-3,4-dihydrochromen-2-one (PubChem CID 141376612) has the molecular formula C20H18ClN3O2S and a molecular weight of 399.90 g/mol. Its IUPAC name is 3-(7-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-yl-3,4-dihydrochromen-2-one.
| Compound Name | 3-(7-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-yl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 141376612 |
| Molecular Formula | C20H18ClN3O2S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 3-(7-chloro-1,3-benzothiazol-2-yl)-7-piperazin-1-yl-3,4-dihydrochromen-2-one |
| SMILES | O=C1Oc2cc(N3CCNCC3)ccc2CC1c1nc2cccc(Cl)c2s1 |
| InChI | InChI=1S/C20H18ClN3O2S/c21-15-2-1-3-16-18(15)27-19(23-16)14-10-12-4-5-13(11-17(12)26-20(14)25)24-8-6-22-7-9-24/h1-5,11,14,22H,6-10H2 |
| InChIKey | IGXRCLXMEQNKSP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|