C20H18FN3O2S — CID 141376638
3-(1,3-benzothiazol-2-yl)-6-fluoro-7-piperazin-1-yl-3,4-dihydrochromen-2-one (PubChem CID 141376638) has the molecular formula C20H18FN3O2S and a molecular weight of 383.45 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-6-fluoro-7-piperazin-1-yl-3,4-dihydrochromen-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-6-fluoro-7-piperazin-1-yl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 141376638 |
| Molecular Formula | C20H18FN3O2S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-6-fluoro-7-piperazin-1-yl-3,4-dihydrochromen-2-one |
| SMILES | O=C1Oc2cc(N3CCNCC3)c(F)cc2CC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H18FN3O2S/c21-14-10-12-9-13(19-23-15-3-1-2-4-18(15)27-19)20(25)26-17(12)11-16(14)24-7-5-22-6-8-24/h1-4,10-11,13,22H,5-9H2 |
| InChIKey | KXUXAKJWNUSORT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|