C20H20N2O2S — CID 141376335
3-(1,3-benzothiazol-2-yl)-7-[1-(dimethylamino)ethyl]-3,4-dihydrochromen-2-one (PubChem CID 141376335) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-[1-(dimethylamino)ethyl]-3,4-dihydrochromen-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-[1-(dimethylamino)ethyl]-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 141376335 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-[1-(dimethylamino)ethyl]-3,4-dihydrochromen-2-one |
| SMILES | CC(c1ccc2c(c1)OC(=O)C(c1nc3ccccc3s1)C2)N(C)C |
| InChI | InChI=1S/C20H20N2O2S/c1-12(22(2)3)13-8-9-14-10-15(20(23)24-17(14)11-13)19-21-16-6-4-5-7-18(16)25-19/h4-9,11-12,15H,10H2,1-3H3 |
| InChIKey | ZAOWIZAHVCNRIJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|