C11H7NO2S2 — CID 86741818
4-(1,3-benzothiazol-2-yl)-5-sulfanylideneoxolan-2-one (PubChem CID 86741818) has the molecular formula C11H7NO2S2 and a molecular weight of 249.32 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-5-sulfanylideneoxolan-2-one.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-5-sulfanylideneoxolan-2-one |
|---|---|
| PubChem CID | 86741818 |
| Molecular Formula | C11H7NO2S2 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-5-sulfanylideneoxolan-2-one |
| SMILES | O=C1CC(c2nc3ccccc3s2)C(=S)O1 |
| InChI | InChI=1S/C11H7NO2S2/c13-9-5-6(11(15)14-9)10-12-7-3-1-2-4-8(7)16-10/h1-4,6H,5H2 |
| InChIKey | BUYSWULSMZLKCQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|