C11H8N2OS2 — CID 88599496
4-(1,3-benzothiazol-2-yl)-5-sulfanylidenepyrrolidin-2-one (PubChem CID 88599496) has the molecular formula C11H8N2OS2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-5-sulfanylidenepyrrolidin-2-one.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-5-sulfanylidenepyrrolidin-2-one |
|---|---|
| PubChem CID | 88599496 |
| Molecular Formula | C11H8N2OS2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-5-sulfanylidenepyrrolidin-2-one |
| SMILES | O=C1CC(c2nc3ccccc3s2)C(=S)N1 |
| InChI | InChI=1S/C11H8N2OS2/c14-9-5-6(10(15)13-9)11-12-7-3-1-2-4-8(7)16-11/h1-4,6H,5H2,(H,13,14,15) |
| InChIKey | ZIQHHVPVZKYRAL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|