C15H11NOS — CID 15442374
2-[(2R,3S)-3-phenyloxiran-2-yl]-1,3-benzothiazole (PubChem CID 15442374) has the molecular formula C15H11NOS and a molecular weight of 253.33 g/mol. Its IUPAC name is 2-[(2R,3S)-3-phenyloxiran-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[(2R,3S)-3-phenyloxiran-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 15442374 |
| Molecular Formula | C15H11NOS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-[(2R,3S)-3-phenyloxiran-2-yl]-1,3-benzothiazole |
| SMILES | c1ccc([C@@H]2O[C@H]2c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C15H11NOS/c1-2-6-10(7-3-1)13-14(17-13)15-16-11-8-4-5-9-12(11)18-15/h1-9,13-14H/t13-,14+/m0/s1 |
| InChIKey | OTGYTYUVJUQFPP-UONOGXRCSA-N |
| XLogP | 4.11 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|