C12H10N2S — CID 5251875
2-(1,2-dihydropyridin-2-yl)-1,3-benzothiazole (PubChem CID 5251875) has the molecular formula C12H10N2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-(1,2-dihydropyridin-2-yl)-1,3-benzothiazole.
| Compound Name | 2-(1,2-dihydropyridin-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 5251875 |
| Molecular Formula | C12H10N2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-(1,2-dihydropyridin-2-yl)-1,3-benzothiazole |
| SMILES | C1=CNC(c2nc3ccccc3s2)C=C1 |
| InChI | InChI=1S/C12H10N2S/c1-2-7-11-9(5-1)14-12(15-11)10-6-3-4-8-13-10/h1-8,10,13H |
| InChIKey | XHZGDCIEFIQOET-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |