C15H17NS — CID 118351557
2-(2,5-dimethylcyclohex-3-en-1-yl)-1,3-benzothiazole (PubChem CID 118351557) has the molecular formula C15H17NS and a molecular weight of 243.37 g/mol. Its IUPAC name is 2-(2,5-dimethylcyclohex-3-en-1-yl)-1,3-benzothiazole.
| Compound Name | 2-(2,5-dimethylcyclohex-3-en-1-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 118351557 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-(2,5-dimethylcyclohex-3-en-1-yl)-1,3-benzothiazole |
| SMILES | CC1C=CC(C)C(c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C15H17NS/c1-10-7-8-11(2)12(9-10)15-16-13-5-3-4-6-14(13)17-15/h3-8,10-12H,9H2,1-2H3 |
| InChIKey | AEPPOQBEVGJKLT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|