C12H14N2OS2 — CID 66218429
3-(1,3-benzothiazol-2-yl)-5-methyl-1,4-thiazinane 1-oxide (PubChem CID 66218429) has the molecular formula C12H14N2OS2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-5-methyl-1,4-thiazinane 1-oxide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-5-methyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 66218429 |
| Molecular Formula | C12H14N2OS2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-5-methyl-1,4-thiazinane 1-oxide |
| SMILES | CC1CS(=O)CC(c2nc3ccccc3s2)N1 |
| InChI | InChI=1S/C12H14N2OS2/c1-8-6-17(15)7-10(13-8)12-14-9-4-2-3-5-11(9)16-12/h2-5,8,10,13H,6-7H2,1H3 |
| InChIKey | XKFKEVOVFZKPBH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |