C32H21N3OS2 — CID 102437419
1,3-bis(1,3-benzothiazol-2-yl)-2-oxo-4,5-diphenylcyclopentane-1-carbonitrile (PubChem CID 102437419) has the molecular formula C32H21N3OS2 and a molecular weight of 527.67 g/mol. Its IUPAC name is 1,3-bis(1,3-benzothiazol-2-yl)-2-oxo-4,5-diphenylcyclopentane-1-carbonitrile.
| Compound Name | 1,3-bis(1,3-benzothiazol-2-yl)-2-oxo-4,5-diphenylcyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 102437419 |
| Molecular Formula | C32H21N3OS2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 1,3-bis(1,3-benzothiazol-2-yl)-2-oxo-4,5-diphenylcyclopentane-1-carbonitrile |
| SMILES | N#CC1(c2nc3ccccc3s2)C(=O)C(c2nc3ccccc3s2)C(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C32H21N3OS2/c33-19-32(31-35-23-16-8-10-18-25(23)38-31)28(21-13-5-2-6-14-21)26(20-11-3-1-4-12-20)27(29(32)36)30-34-22-15-7-9-17-24(22)37-30/h1-18,26-28H |
| InChIKey | VLHDCFPVBYLVKD-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 66.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |