C15H9N5O4S — CID 98388884
N-[(Z)-[(4S)-4-(1,3-benzothiazol-2-yl)-2,5,6-trioxopiperidin-3-ylidene]amino]-2-cyanoacetamide (PubChem CID 98388884) has the molecular formula C15H9N5O4S and a molecular weight of 355.34 g/mol. Its IUPAC name is N-[(Z)-[(4S)-4-(1,3-benzothiazol-2-yl)-2,5,6-trioxopiperidin-3-ylidene]amino]-2-cyanoacetamide.
| Compound Name | N-[(Z)-[(4S)-4-(1,3-benzothiazol-2-yl)-2,5,6-trioxopiperidin-3-ylidene]amino]-2-cyanoacetamide |
|---|---|
| PubChem CID | 98388884 |
| Molecular Formula | C15H9N5O4S |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-[(Z)-[(4S)-4-(1,3-benzothiazol-2-yl)-2,5,6-trioxopiperidin-3-ylidene]amino]-2-cyanoacetamide |
| SMILES | N#CCC(=O)N/N=C1\C(=O)NC(=O)C(=O)[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H9N5O4S/c16-6-5-9(21)19-20-11-10(12(22)14(24)18-13(11)23)15-17-7-3-1-2-4-8(7)25-15/h1-4,10H,5H2,(H,19,21)(H,18,23,24)/b20-11-/t10-/m0/s1 |
| InChIKey | RQLZOGZUNJPJSN-XLUTVVKMSA-N |
| XLogP | -0.01 |
| TPSA | 141.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|