C21H18N6O4S — CID 98553815
1-amino-3-[(Z)-[(4S)-4-(1,3-benzothiazol-2-yl)-1-(2,5-dimethylphenyl)-2,5,6-trioxopiperidin-3-ylidene]amino]urea (PubChem CID 98553815) has the molecular formula C21H18N6O4S and a molecular weight of 450.48 g/mol. Its IUPAC name is 1-amino-3-[(Z)-[(4S)-4-(1,3-benzothiazol-2-yl)-1-(2,5-dimethylphenyl)-2,5,6-trioxopiperidin-3-ylidene]amino]urea.
| Compound Name | 1-amino-3-[(Z)-[(4S)-4-(1,3-benzothiazol-2-yl)-1-(2,5-dimethylphenyl)-2,5,6-trioxopiperidin-3-ylidene]amino]urea |
|---|---|
| PubChem CID | 98553815 |
| Molecular Formula | C21H18N6O4S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 1-amino-3-[(Z)-[(4S)-4-(1,3-benzothiazol-2-yl)-1-(2,5-dimethylphenyl)-2,5,6-trioxopiperidin-3-ylidene]amino]urea |
| SMILES | Cc1ccc(C)c(N2C(=O)C(=O)[C@@H](c3nc4ccccc4s3)/C(=N/NC(=O)NN)C2=O)c1 |
| InChI | InChI=1S/C21H18N6O4S/c1-10-7-8-11(2)13(9-10)27-19(29)16(25-26-21(31)24-22)15(17(28)20(27)30)18-23-12-5-3-4-6-14(12)32-18/h3-9,15H,22H2,1-2H3,(H2,24,26,31)/b25-16-/t15-/m0/s1 |
| InChIKey | ZNYHPZWSURWMDY-CRAHXNDLSA-N |
| XLogP | 1.67 |
| TPSA | 146.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|