C19H14N4O5S2 — CID 92524971
N-[(Z)-[(4S)-4-(1,3-benzothiazol-2-yl)-2,5,6-trioxopiperidin-3-ylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 92524971) has the molecular formula C19H14N4O5S2 and a molecular weight of 442.48 g/mol. Its IUPAC name is N-[(Z)-[(4S)-4-(1,3-benzothiazol-2-yl)-2,5,6-trioxopiperidin-3-ylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-[(4S)-4-(1,3-benzothiazol-2-yl)-2,5,6-trioxopiperidin-3-ylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 92524971 |
| Molecular Formula | C19H14N4O5S2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | N-[(Z)-[(4S)-4-(1,3-benzothiazol-2-yl)-2,5,6-trioxopiperidin-3-ylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2\C(=O)NC(=O)C(=O)[C@H]2c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H14N4O5S2/c1-10-6-8-11(9-7-10)30(27,28)23-22-15-14(16(24)18(26)21-17(15)25)19-20-12-4-2-3-5-13(12)29-19/h2-9,14,23H,1H3,(H,21,25,26)/b22-15-/t14-/m0/s1 |
| InChIKey | TUMIOWCOXVEAAH-LWOZTNPUSA-N |
| XLogP | 1.25 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|