C14H13N3O2S2 — CID 175368644
N'-(4-methylphenyl)-1,3-benzothiazole-2-sulfonohydrazide (PubChem CID 175368644) has the molecular formula C14H13N3O2S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is N'-(4-methylphenyl)-1,3-benzothiazole-2-sulfonohydrazide.
| Compound Name | N'-(4-methylphenyl)-1,3-benzothiazole-2-sulfonohydrazide |
|---|---|
| PubChem CID | 175368644 |
| Molecular Formula | C14H13N3O2S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N'-(4-methylphenyl)-1,3-benzothiazole-2-sulfonohydrazide |
| SMILES | Cc1ccc(NNS(=O)(=O)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C14H13N3O2S2/c1-10-6-8-11(9-7-10)16-17-21(18,19)14-15-12-4-2-3-5-13(12)20-14/h2-9,16-17H,1H3 |
| InChIKey | DWHCGVORMIUDQQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|