C21H18N2O3S3 — CID 1187092
N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxy-5-methylphenyl]-4-methylbenzenesulfonamide (PubChem CID 1187092) has the molecular formula C21H18N2O3S3 and a molecular weight of 442.59 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxy-5-methylphenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxy-5-methylphenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 1187092 |
| Molecular Formula | C21H18N2O3S3 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxy-5-methylphenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C)c(O)c(Sc3nc4ccccc4s3)c2)cc1 |
| InChI | InChI=1S/C21H18N2O3S3/c1-13-7-9-16(10-8-13)29(25,26)23-15-11-14(2)20(24)19(12-15)28-21-22-17-5-3-4-6-18(17)27-21/h3-12,23-24H,1-2H3 |
| InChIKey | JZWUGBARYBOIMD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|