C13H12N6O3S — CID 98390401
1-amino-3-[(E)-[(4R)-4-(1,3-benzothiazol-2-yl)-5,6-dioxopiperidin-3-ylidene]amino]urea (PubChem CID 98390401) has the molecular formula C13H12N6O3S and a molecular weight of 332.35 g/mol. Its IUPAC name is 1-amino-3-[(E)-[(4R)-4-(1,3-benzothiazol-2-yl)-5,6-dioxopiperidin-3-ylidene]amino]urea.
| Compound Name | 1-amino-3-[(E)-[(4R)-4-(1,3-benzothiazol-2-yl)-5,6-dioxopiperidin-3-ylidene]amino]urea |
|---|---|
| PubChem CID | 98390401 |
| Molecular Formula | C13H12N6O3S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 1-amino-3-[(E)-[(4R)-4-(1,3-benzothiazol-2-yl)-5,6-dioxopiperidin-3-ylidene]amino]urea |
| SMILES | NNC(=O)N/N=C1/CNC(=O)C(=O)[C@@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H12N6O3S/c14-17-13(22)19-18-7-5-15-11(21)10(20)9(7)12-16-6-3-1-2-4-8(6)23-12/h1-4,9H,5,14H2,(H,15,21)(H2,17,19,22)/b18-7-/t9-/m1/s1 |
| InChIKey | YWYLWUQLRABBMJ-FLGMGOKFSA-N |
| XLogP | -0.39 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|