C24H22N4O4S2 — CID 19159660
(4E)-N-(1,3-benzothiazol-2-yl)-3-methyl-4-[(4-methylphenyl)sulfonylhydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19159660) has the molecular formula C24H22N4O4S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is (4E)-N-(1,3-benzothiazol-2-yl)-3-methyl-4-[(4-methylphenyl)sulfonylhydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(1,3-benzothiazol-2-yl)-3-methyl-4-[(4-methylphenyl)sulfonylhydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19159660 |
| Molecular Formula | C24H22N4O4S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | (4E)-N-(1,3-benzothiazol-2-yl)-3-methyl-4-[(4-methylphenyl)sulfonylhydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2\CCCc3oc(C(=O)Nc4nc5ccccc5s4)c(C)c32)cc1 |
| InChI | InChI=1S/C24H22N4O4S2/c1-14-10-12-16(13-11-14)34(30,31)28-27-18-7-5-8-19-21(18)15(2)22(32-19)23(29)26-24-25-17-6-3-4-9-20(17)33-24/h3-4,6,9-13,28H,5,7-8H2,1-2H3,(H,25,26,29)/b27-18+ |
| InChIKey | AKVGIRQMXGCZBN-OVVQPSECSA-N |
| XLogP | 4.78 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|