C24H19ClN4O3S — CID 19157478
(4E)-N-(1,3-benzothiazol-2-yl)-4-[(3-chlorobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19157478) has the molecular formula C24H19ClN4O3S and a molecular weight of 478.96 g/mol. Its IUPAC name is (4E)-N-(1,3-benzothiazol-2-yl)-4-[(3-chlorobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(1,3-benzothiazol-2-yl)-4-[(3-chlorobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19157478 |
| Molecular Formula | C24H19ClN4O3S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | (4E)-N-(1,3-benzothiazol-2-yl)-4-[(3-chlorobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2nc3ccccc3s2)oc2c1/C(=N/NC(=O)c1cccc(Cl)c1)CCC2 |
| InChI | InChI=1S/C24H19ClN4O3S/c1-13-20-17(28-29-22(30)14-6-4-7-15(25)12-14)9-5-10-18(20)32-21(13)23(31)27-24-26-16-8-2-3-11-19(16)33-24/h2-4,6-8,11-12H,5,9-10H2,1H3,(H,29,30)(H,26,27,31)/b28-17+ |
| InChIKey | WTONAYCGQNGOPW-OGLMXYFKSA-N |
| XLogP | 5.57 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|