C20H22N2O2S2 — CID 18270059
2-[1-(2,5-dimethylphenyl)sulfonylpiperidin-2-yl]-1,3-benzothiazole (PubChem CID 18270059) has the molecular formula C20H22N2O2S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 2-[1-(2,5-dimethylphenyl)sulfonylpiperidin-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-(2,5-dimethylphenyl)sulfonylpiperidin-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 18270059 |
| Molecular Formula | C20H22N2O2S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-[1-(2,5-dimethylphenyl)sulfonylpiperidin-2-yl]-1,3-benzothiazole |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCCCC2c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C20H22N2O2S2/c1-14-10-11-15(2)19(13-14)26(23,24)22-12-6-5-8-17(22)20-21-16-7-3-4-9-18(16)25-20/h3-4,7,9-11,13,17H,5-6,8,12H2,1-2H3 |
| InChIKey | NLEKQTLCBKAYCR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |