C19H23NO2S — CID 50747098
1-(2,5-dimethylphenyl)sulfonyl-2-(4-methylphenyl)pyrrolidine (PubChem CID 50747098) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfonyl-2-(4-methylphenyl)pyrrolidine.
| Compound Name | 1-(2,5-dimethylphenyl)sulfonyl-2-(4-methylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 50747098 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfonyl-2-(4-methylphenyl)pyrrolidine |
| SMILES | Cc1ccc(C2CCCN2S(=O)(=O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C19H23NO2S/c1-14-7-10-17(11-8-14)18-5-4-12-20(18)23(21,22)19-13-15(2)6-9-16(19)3/h6-11,13,18H,4-5,12H2,1-3H3 |
| InChIKey | DQKYNJINVZHCDW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |